C29H31NO5S — CID 22120844
methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-3-[(4-hydroxyphenyl)methyl]anilino]acetate (PubChem CID 22120844) has the molecular formula C29H31NO5S and a molecular weight of 505.64 g/mol. Its IUPAC name is methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-3-[(4-hydroxyphenyl)methyl]anilino]acetate.
| Compound Name | methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-3-[(4-hydroxyphenyl)methyl]anilino]acetate |
|---|---|
| PubChem CID | 22120844 |
| Molecular Formula | C29H31NO5S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-3-[(4-hydroxyphenyl)methyl]anilino]acetate |
| SMILES | COC(=O)CN(C(=O)C(CCc1ccccc1)CSC(C)=O)c1cccc(Cc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C29H31NO5S/c1-21(31)36-20-25(14-11-22-7-4-3-5-8-22)29(34)30(19-28(33)35-2)26-10-6-9-24(18-26)17-23-12-15-27(32)16-13-23/h3-10,12-13,15-16,18,25,32H,11,14,17,19-20H2,1-2H3 |
| InChIKey | YBDNSTJEIJCKNT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|