C28H30N2O5S — CID 22120869
methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-(pyridin-2-ylmethoxy)anilino]acetate (PubChem CID 22120869) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-(pyridin-2-ylmethoxy)anilino]acetate.
| Compound Name | methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-(pyridin-2-ylmethoxy)anilino]acetate |
|---|---|
| PubChem CID | 22120869 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | methyl 2-[N-[2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-(pyridin-2-ylmethoxy)anilino]acetate |
| SMILES | COC(=O)CN(C(=O)C(CCc1ccccc1)CSC(C)=O)c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C28H30N2O5S/c1-21(31)36-20-23(12-11-22-8-4-3-5-9-22)28(33)30(18-27(32)34-2)25-13-15-26(16-14-25)35-19-24-10-6-7-17-29-24/h3-10,13-17,23H,11-12,18-20H2,1-2H3 |
| InChIKey | WJJOLKIJVRXCJV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|