C19H21NO4S — CID 139831356
(2R)-2-[[(2S)-4-phenoxy-2-(sulfanylmethyl)butanoyl]amino]-2-phenylacetic acid (PubChem CID 139831356) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2R)-2-[[(2S)-4-phenoxy-2-(sulfanylmethyl)butanoyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[(2S)-4-phenoxy-2-(sulfanylmethyl)butanoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 139831356 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2R)-2-[[(2S)-4-phenoxy-2-(sulfanylmethyl)butanoyl]amino]-2-phenylacetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)c1ccccc1)[C@@H](CS)CCOc1ccccc1 |
| InChI | InChI=1S/C19H21NO4S/c21-18(20-17(19(22)23)14-7-3-1-4-8-14)15(13-25)11-12-24-16-9-5-2-6-10-16/h1-10,15,17,25H,11-13H2,(H,20,21)(H,22,23)/t15-,17-/m1/s1 |
| InChIKey | XFWWRVUQUOWENT-NVXWUHKLSA-N |
| XLogP | 2.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|