C16H16OS2 — CID 42612197
(2,2-dimethylthiochromen-4-yl)-thiophen-3-ylmethanol (PubChem CID 42612197) has the molecular formula C16H16OS2 and a molecular weight of 288.44 g/mol. Its IUPAC name is (2,2-dimethylthiochromen-4-yl)-thiophen-3-ylmethanol.
| Compound Name | (2,2-dimethylthiochromen-4-yl)-thiophen-3-ylmethanol |
|---|---|
| PubChem CID | 42612197 |
| Molecular Formula | C16H16OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (2,2-dimethylthiochromen-4-yl)-thiophen-3-ylmethanol |
| SMILES | CC1(C)C=C(C(O)c2ccsc2)c2ccccc2S1 |
| InChI | InChI=1S/C16H16OS2/c1-16(2)9-13(15(17)11-7-8-18-10-11)12-5-3-4-6-14(12)19-16/h3-10,15,17H,1-2H3 |
| InChIKey | XMWTXKCAOOOCNA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |