About 1-thiophen-3-ylethanol
1-thiophen-3-ylethanol (PubChem CID 12744375) has the molecular formula C6H8OS
and a molecular weight of 128.20 g/mol. Its IUPAC name is 1-thiophen-3-ylethanol.
Molecular Properties
| Compound Name | 1-thiophen-3-ylethanol |
| PubChem CID | 12744375 |
| Molecular Formula | C6H8OS |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 1-thiophen-3-ylethanol |
| SMILES | CC(O)c1ccsc1 |
| InChI | InChI=1S/C6H8OS/c1-5(7)6-2-3-8-4-6/h2-5,7H,1H3 |
| InChIKey | AJKKZEHIYREOFF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-thiophen-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiophen-3-ylethanol?
The IUPAC name of 1-thiophen-3-ylethanol (CID 12744375) is 1-thiophen-3-ylethanol.
What is the SMILES notation for 1-thiophen-3-ylethanol?
The canonical SMILES for 1-thiophen-3-ylethanol is CC(O)c1ccsc1.
What is the InChIKey of 1-thiophen-3-ylethanol?
The InChIKey is AJKKZEHIYREOFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS/c1-5(7)6-2-3-8-4-6/h2-5,7H,1H3.
What are the key properties of 1-thiophen-3-ylethanol?
1-thiophen-3-ylethanol has a molecular weight of 128.20 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiophen-3-ylethanol is sourced from PubChem (CID 12744375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).