C14H17F3O2S2 — CID 158976619
1-thiophen-3-ylethanol;1,1,1-trifluoro-3-thiophen-3-ylbutan-2-ol (PubChem CID 158976619) has the molecular formula C14H17F3O2S2 and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-thiophen-3-ylethanol;1,1,1-trifluoro-3-thiophen-3-ylbutan-2-ol.
| Compound Name | 1-thiophen-3-ylethanol;1,1,1-trifluoro-3-thiophen-3-ylbutan-2-ol |
|---|---|
| PubChem CID | 158976619 |
| Molecular Formula | C14H17F3O2S2 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-thiophen-3-ylethanol;1,1,1-trifluoro-3-thiophen-3-ylbutan-2-ol |
| SMILES | CC(O)c1ccsc1.CC(c1ccsc1)C(O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3OS.C6H8OS/c1-5(6-2-3-13-4-6)7(12)8(9,10)11;1-5(7)6-2-3-8-4-6/h2-5,7,12H,1H3;2-5,7H,1H3 |
| InChIKey | JOLYFQNIGMULKC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |