C13H14OS2 — CID 67673002
2,4-di(thiophen-3-yl)pentan-3-one (PubChem CID 67673002) has the molecular formula C13H14OS2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2,4-di(thiophen-3-yl)pentan-3-one.
| Compound Name | 2,4-di(thiophen-3-yl)pentan-3-one |
|---|---|
| PubChem CID | 67673002 |
| Molecular Formula | C13H14OS2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2,4-di(thiophen-3-yl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C13H14OS2/c1-9(11-3-5-15-7-11)13(14)10(2)12-4-6-16-8-12/h3-10H,1-2H3 |
| InChIKey | DJCAPTWYPURCJC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |