C7H10N2O2S — CID 23821299
1-hydroxy-3-(1-thiophen-3-ylethyl)urea (PubChem CID 23821299) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 1-hydroxy-3-(1-thiophen-3-ylethyl)urea.
| Compound Name | 1-hydroxy-3-(1-thiophen-3-ylethyl)urea |
|---|---|
| PubChem CID | 23821299 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 1-hydroxy-3-(1-thiophen-3-ylethyl)urea |
| SMILES | CC(NC(=O)NO)c1ccsc1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5(8-7(10)9-11)6-2-3-12-4-6/h2-5,11H,1H3,(H2,8,9,10) |
| InChIKey | AAUOVUVLPKPKMI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|