C8H10ClNOS — CID 62842251
2-chloro-N-(1-thiophen-3-ylethyl)acetamide (PubChem CID 62842251) has the molecular formula C8H10ClNOS and a molecular weight of 203.69 g/mol. Its IUPAC name is 2-chloro-N-(1-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-chloro-N-(1-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 62842251 |
| Molecular Formula | C8H10ClNOS |
| Molecular Weight | 203.69 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 2-chloro-N-(1-thiophen-3-ylethyl)acetamide |
| SMILES | CC(NC(=O)CCl)c1ccsc1 |
| InChI | InChI=1S/C8H10ClNOS/c1-6(10-8(11)4-9)7-2-3-12-5-7/h2-3,5-6H,4H2,1H3,(H,10,11) |
| InChIKey | GZVQDQFPSWKEJN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|