C12H20N2OS — CID 62844569
(2S,3S)-2-amino-3-methyl-N-(1-thiophen-3-ylethyl)pentanamide (PubChem CID 62844569) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-(1-thiophen-3-ylethyl)pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-(1-thiophen-3-ylethyl)pentanamide |
|---|---|
| PubChem CID | 62844569 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-(1-thiophen-3-ylethyl)pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NC(C)c1ccsc1 |
| InChI | InChI=1S/C12H20N2OS/c1-4-8(2)11(13)12(15)14-9(3)10-5-6-16-7-10/h5-9,11H,4,13H2,1-3H3,(H,14,15)/t8-,9?,11-/m0/s1 |
| InChIKey | BRDZHKFLVKBJBW-QCZWPSDZSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |