C13H19NO3S — CID 91644897
(2S,3S)-3-methyl-2-(2-thiophen-3-ylpropanoylamino)pentanoic acid (PubChem CID 91644897) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(2-thiophen-3-ylpropanoylamino)pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-(2-thiophen-3-ylpropanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 91644897 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2S,3S)-3-methyl-2-(2-thiophen-3-ylpropanoylamino)pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(C)c1ccsc1)C(=O)O |
| InChI | InChI=1S/C13H19NO3S/c1-4-8(2)11(13(16)17)14-12(15)9(3)10-5-6-18-7-10/h5-9,11H,4H2,1-3H3,(H,14,15)(H,16,17)/t8-,9?,11-/m0/s1 |
| InChIKey | SQCCWXPBDQJYQE-QCZWPSDZSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |