C25H27O5P — CID 11797281
[(1S,2R)-2-diphenylphosphoryl-4-hydroxy-1-(4-methoxyphenyl)butyl] acetate (PubChem CID 11797281) has the molecular formula C25H27O5P and a molecular weight of 438.46 g/mol. Its IUPAC name is [(1S,2R)-2-diphenylphosphoryl-4-hydroxy-1-(4-methoxyphenyl)butyl] acetate.
| Compound Name | [(1S,2R)-2-diphenylphosphoryl-4-hydroxy-1-(4-methoxyphenyl)butyl] acetate |
|---|---|
| PubChem CID | 11797281 |
| Molecular Formula | C25H27O5P |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [(1S,2R)-2-diphenylphosphoryl-4-hydroxy-1-(4-methoxyphenyl)butyl] acetate |
| SMILES | COc1ccc([C@H](OC(C)=O)[C@@H](CCO)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27O5P/c1-19(27)30-25(20-13-15-21(29-2)16-14-20)24(17-18-26)31(28,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16,24-26H,17-18H2,1-2H3/t24-,25+/m1/s1 |
| InChIKey | RNDRKZHDMPMCKK-RPBOFIJWSA-N |
| XLogP | 4.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|