C22H23O3P — CID 13152614
(1S,2S)-2-diphenylphosphoryl-1-(4-methoxyphenyl)propan-1-ol (PubChem CID 13152614) has the molecular formula C22H23O3P and a molecular weight of 366.40 g/mol. Its IUPAC name is (1S,2S)-2-diphenylphosphoryl-1-(4-methoxyphenyl)propan-1-ol.
| Compound Name | (1S,2S)-2-diphenylphosphoryl-1-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 13152614 |
| Molecular Formula | C22H23O3P |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (1S,2S)-2-diphenylphosphoryl-1-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc([C@H](O)[C@H](C)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23O3P/c1-17(22(23)18-13-15-19(25-2)16-14-18)26(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-17,22-23H,1-2H3/t17-,22+/m0/s1 |
| InChIKey | ISLFCRLVRYFWSB-HTAPYJJXSA-N |
| XLogP | 4.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|