C15H25O6P — CID 101193123
(1R,2S)-1-di(propan-2-yloxy)phosphoryl-2-(4-methoxyphenyl)ethane-1,2-diol (PubChem CID 101193123) has the molecular formula C15H25O6P and a molecular weight of 332.33 g/mol. Its IUPAC name is (1R,2S)-1-di(propan-2-yloxy)phosphoryl-2-(4-methoxyphenyl)ethane-1,2-diol.
| Compound Name | (1R,2S)-1-di(propan-2-yloxy)phosphoryl-2-(4-methoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 101193123 |
| Molecular Formula | C15H25O6P |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (1R,2S)-1-di(propan-2-yloxy)phosphoryl-2-(4-methoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc([C@H](O)[C@H](O)P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C15H25O6P/c1-10(2)20-22(18,21-11(3)4)15(17)14(16)12-6-8-13(19-5)9-7-12/h6-11,14-17H,1-5H3/t14-,15+/m0/s1 |
| InChIKey | PDQFZZUFEBZMFM-LSDHHAIUSA-N |
| XLogP | 3.09 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|