C10H16O8P2 — CID 91135841
[dimethoxyphosphoryl-(4-methoxyphenyl)methyl] dihydrogen phosphate (PubChem CID 91135841) has the molecular formula C10H16O8P2 and a molecular weight of 326.18 g/mol. Its IUPAC name is [dimethoxyphosphoryl-(4-methoxyphenyl)methyl] dihydrogen phosphate.
| Compound Name | [dimethoxyphosphoryl-(4-methoxyphenyl)methyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91135841 |
| Molecular Formula | C10H16O8P2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | [dimethoxyphosphoryl-(4-methoxyphenyl)methyl] dihydrogen phosphate |
| SMILES | COc1ccc(C(OP(=O)(O)O)P(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C10H16O8P2/c1-15-9-6-4-8(5-7-9)10(18-20(12,13)14)19(11,16-2)17-3/h4-7,10H,1-3H3,(H2,12,13,14) |
| InChIKey | ZCZQOYIYCPOBSM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|