C16H18O7P2 — CID 23280611
2-[dimethoxyphosphoryl-(4-methoxyphenyl)methoxy]-1,3,2-benzodioxaphosphole (PubChem CID 23280611) has the molecular formula C16H18O7P2 and a molecular weight of 384.26 g/mol. Its IUPAC name is 2-[dimethoxyphosphoryl-(4-methoxyphenyl)methoxy]-1,3,2-benzodioxaphosphole.
| Compound Name | 2-[dimethoxyphosphoryl-(4-methoxyphenyl)methoxy]-1,3,2-benzodioxaphosphole |
|---|---|
| PubChem CID | 23280611 |
| Molecular Formula | C16H18O7P2 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-[dimethoxyphosphoryl-(4-methoxyphenyl)methoxy]-1,3,2-benzodioxaphosphole |
| SMILES | COc1ccc(C(OP2Oc3ccccc3O2)P(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C16H18O7P2/c1-18-13-10-8-12(9-11-13)16(25(17,19-2)20-3)23-24-21-14-6-4-5-7-15(14)22-24/h4-11,16H,1-3H3 |
| InChIKey | XGTPHNLJRPBPIL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|