C16H21NO4P+ — CID 91935310
[(R)-(4-methoxyphenyl)-phosphonomethyl]-[(1S)-1-phenylethyl]azanium (PubChem CID 91935310) has the molecular formula C16H21NO4P+ and a molecular weight of 322.32 g/mol. Its IUPAC name is [(R)-(4-methoxyphenyl)-phosphonomethyl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [(R)-(4-methoxyphenyl)-phosphonomethyl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 91935310 |
| Molecular Formula | C16H21NO4P+ |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(R)-(4-methoxyphenyl)-phosphonomethyl]-[(1S)-1-phenylethyl]azanium |
| SMILES | COc1ccc([C@H]([NH2+][C@@H](C)c2ccccc2)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C16H20NO4P/c1-12(13-6-4-3-5-7-13)17-16(22(18,19)20)14-8-10-15(21-2)11-9-14/h3-12,16-17H,1-2H3,(H2,18,19,20)/p+1/t12-,16+/m0/s1 |
| InChIKey | SMDIVUHOEDWVRD-BLLLJJGKSA-O |
| XLogP | 2.20 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|