C16H21ClNO4P — CID 44586809
[(S)-(4-methoxyphenyl)-phosphonomethyl]-[(1R)-1-phenylethyl]azanium chloride (PubChem CID 44586809) has the molecular formula C16H21ClNO4P and a molecular weight of 357.77 g/mol. Its IUPAC name is [(S)-(4-methoxyphenyl)-phosphonomethyl]-[(1R)-1-phenylethyl]azanium chloride.
| Compound Name | [(S)-(4-methoxyphenyl)-phosphonomethyl]-[(1R)-1-phenylethyl]azanium chloride |
|---|---|
| PubChem CID | 44586809 |
| Molecular Formula | C16H21ClNO4P |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [(S)-(4-methoxyphenyl)-phosphonomethyl]-[(1R)-1-phenylethyl]azanium chloride |
| SMILES | COc1ccc([C@@H]([NH2+][C@H](C)c2ccccc2)P(=O)(O)O)cc1.[Cl-] |
| InChI | InChI=1S/C16H20NO4P.ClH/c1-12(13-6-4-3-5-7-13)17-16(22(18,19)20)14-8-10-15(21-2)11-9-14;/h3-12,16-17H,1-2H3,(H2,18,19,20);1H/t12-,16+;/m1./s1 |
| InChIKey | ICRHWAQVCACTBE-KKJWGQAZSA-N |
| XLogP | -0.80 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|