C8H12O7P2S — CID 18515645
[(4-methoxyphenyl)sulfanyl-phosphonomethyl]phosphonic acid (PubChem CID 18515645) has the molecular formula C8H12O7P2S and a molecular weight of 314.19 g/mol. Its IUPAC name is [(4-methoxyphenyl)sulfanyl-phosphonomethyl]phosphonic acid.
| Compound Name | [(4-methoxyphenyl)sulfanyl-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 18515645 |
| Molecular Formula | C8H12O7P2S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | [(4-methoxyphenyl)sulfanyl-phosphonomethyl]phosphonic acid |
| SMILES | COc1ccc(SC(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C8H12O7P2S/c1-15-6-2-4-7(5-3-6)18-8(16(9,10)11)17(12,13)14/h2-5,8H,1H3,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | SKSJAPLGBBDPTI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|