C17H27BrNO5P — CID 11154810
N-[(1R,2S)-2-bromo-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 11154810) has the molecular formula C17H27BrNO5P and a molecular weight of 436.28 g/mol. Its IUPAC name is N-[(1R,2S)-2-bromo-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | N-[(1R,2S)-2-bromo-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 11154810 |
| Molecular Formula | C17H27BrNO5P |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[(1R,2S)-2-bromo-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc([C@@H](NC(C)=O)[C@H](Br)P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C17H27BrNO5P/c1-11(2)23-25(21,24-12(3)4)17(18)16(19-13(5)20)14-7-9-15(22-6)10-8-14/h7-12,16-17H,1-6H3,(H,19,20)/t16-,17-/m1/s1 |
| InChIKey | PNJATQJEHATTOU-IAGOWNOFSA-N |
| XLogP | 4.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|