C26H29O3P — CID 13203120
(1R,2S)-2-diphenylphosphoryl-1-[4-(3-methylbut-2-enoxy)phenyl]propan-1-ol (PubChem CID 13203120) has the molecular formula C26H29O3P and a molecular weight of 420.49 g/mol. Its IUPAC name is (1R,2S)-2-diphenylphosphoryl-1-[4-(3-methylbut-2-enoxy)phenyl]propan-1-ol.
| Compound Name | (1R,2S)-2-diphenylphosphoryl-1-[4-(3-methylbut-2-enoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 13203120 |
| Molecular Formula | C26H29O3P |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (1R,2S)-2-diphenylphosphoryl-1-[4-(3-methylbut-2-enoxy)phenyl]propan-1-ol |
| SMILES | CC(C)=CCOc1ccc([C@@H](O)[C@H](C)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29O3P/c1-20(2)18-19-29-23-16-14-22(15-17-23)26(27)21(3)30(28,24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-18,21,26-27H,19H2,1-3H3/t21-,26-/m0/s1 |
| InChIKey | QXQYEBIJNHHFBH-LVXARBLLSA-N |
| XLogP | 5.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|