C20H29NO4 — CID 88911918
(2S)-N-formyl-N-hydroxy-4-methyl-2-[(1S)-1-[4-(3-methylbut-2-enoxy)phenyl]ethyl]pentanamide (PubChem CID 88911918) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2S)-N-formyl-N-hydroxy-4-methyl-2-[(1S)-1-[4-(3-methylbut-2-enoxy)phenyl]ethyl]pentanamide.
| Compound Name | (2S)-N-formyl-N-hydroxy-4-methyl-2-[(1S)-1-[4-(3-methylbut-2-enoxy)phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 88911918 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (2S)-N-formyl-N-hydroxy-4-methyl-2-[(1S)-1-[4-(3-methylbut-2-enoxy)phenyl]ethyl]pentanamide |
| SMILES | CC(C)=CCOc1ccc([C@@H](C)[C@H](CC(C)C)C(=O)N(O)C=O)cc1 |
| InChI | InChI=1S/C20H29NO4/c1-14(2)10-11-25-18-8-6-17(7-9-18)16(5)19(12-15(3)4)20(23)21(24)13-22/h6-10,13,15-16,19,24H,11-12H2,1-5H3/t16-,19+/m1/s1 |
| InChIKey | SODJGWXFZZIINV-APWZRJJASA-N |
| XLogP | 4.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|