C28H34BNO5 — CID 122213580
N,N-bis(4-methoxyphenyl)-4-[1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]ethyl]aniline (PubChem CID 122213580) has the molecular formula C28H34BNO5 and a molecular weight of 475.39 g/mol. Its IUPAC name is N,N-bis(4-methoxyphenyl)-4-[1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]ethyl]aniline.
| Compound Name | N,N-bis(4-methoxyphenyl)-4-[1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]ethyl]aniline |
|---|---|
| PubChem CID | 122213580 |
| Molecular Formula | C28H34BNO5 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N,N-bis(4-methoxyphenyl)-4-[1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]ethyl]aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(C(C)OB3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C28H34BNO5/c1-20(33-29-34-27(2,3)28(4,5)35-29)21-8-10-22(11-9-21)30(23-12-16-25(31-6)17-13-23)24-14-18-26(32-7)19-15-24/h8-20H,1-7H3 |
| InChIKey | WOXIPCYJEJZCMD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|