C18H33BF2O4 — CID 146165122
ethyl (4R)-2,2-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanoate (PubChem CID 146165122) has the molecular formula C18H33BF2O4 and a molecular weight of 362.27 g/mol. Its IUPAC name is ethyl (4R)-2,2-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanoate.
| Compound Name | ethyl (4R)-2,2-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanoate |
|---|---|
| PubChem CID | 146165122 |
| Molecular Formula | C18H33BF2O4 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | ethyl (4R)-2,2-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanoate |
| SMILES | CCCCCC[C@H](CC(F)(F)C(=O)OCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H33BF2O4/c1-7-9-10-11-12-14(13-18(20,21)15(22)23-8-2)19-24-16(3,4)17(5,6)25-19/h14H,7-13H2,1-6H3/t14-/m1/s1 |
| InChIKey | YOIKKANTOWSWSS-CQSZACIVSA-N |
| XLogP | 5.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|