C22H24Cl2O4 — CID 162264525
4-chlorobenzaldehyde;(1R)-1-(4-chlorophenyl)but-3-en-1-ol;prop-2-enyl acetate (PubChem CID 162264525) has the molecular formula C22H24Cl2O4 and a molecular weight of 423.34 g/mol. Its IUPAC name is 4-chlorobenzaldehyde;(1R)-1-(4-chlorophenyl)but-3-en-1-ol;prop-2-enyl acetate.
| Compound Name | 4-chlorobenzaldehyde;(1R)-1-(4-chlorophenyl)but-3-en-1-ol;prop-2-enyl acetate |
|---|---|
| PubChem CID | 162264525 |
| Molecular Formula | C22H24Cl2O4 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-chlorobenzaldehyde;(1R)-1-(4-chlorophenyl)but-3-en-1-ol;prop-2-enyl acetate |
| SMILES | C=CCOC(C)=O.C=CC[C@@H](O)c1ccc(Cl)cc1.O=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClO.C7H5ClO.C5H8O2/c1-2-3-10(12)8-4-6-9(11)7-5-8;8-7-3-1-6(5-9)2-4-7;1-3-4-7-5(2)6/h2,4-7,10,12H,1,3H2;1-5H;3H,1,4H2,2H3/t10-;;/m1../s1 |
| InChIKey | ZZSFSOXUTFANIE-YQFADDPSSA-N |
| XLogP | 5.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|