About naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate
naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate (PubChem CID 159972832) has the molecular formula C30H30O4
and a molecular weight of 454.57 g/mol. Its IUPAC name is naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate.
Molecular Properties
| Compound Name | naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate |
| PubChem CID | 159972832 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate |
| SMILES | C=CCC(O)c1cccc2ccccc12.C=CCOC(C)=O.O=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C14H14O.C11H8O.C5H8O2/c1-2-6-14(15)13-10-5-8-11-7-3-4-9-12(11)13;12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-3-4-7-5(2)6/h2-5,7-10,14-15H,1,6H2;1-8H;3H,1,4H2,2H3 |
| InChIKey | OETSYEJESNRHMW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate?
The IUPAC name of naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate (CID 159972832) is naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate.
What is the SMILES notation for naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate?
The canonical SMILES for naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate is C=CCC(O)c1cccc2ccccc12.C=CCOC(C)=O.O=Cc1cccc2ccccc12.
What is the InChIKey of naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate?
The InChIKey is OETSYEJESNRHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C11H8O.C5H8O2/c1-2-6-14(15)13-10-5-8-11-7-3-4-9-12(11)13;12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-3-4-7-5(2)6/h2-5,7-10,14-15H,1,6H2;1-8H;3H,1,4H2,2H3.
What are the key properties of naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate?
naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate has a molecular weight of 454.57 g/mol, XLogP of 6.84, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1-carbaldehyde;1-naphthalen-1-ylbut-3-en-1-ol;prop-2-enyl acetate is sourced from PubChem (CID 159972832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).