C18H18O4 — CID 174850169
4-[1-[4-[(1R)-1,2-dihydroxyethyl]phenyl]-2-oxopropyl]benzaldehyde (PubChem CID 174850169) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[1-[4-[(1R)-1,2-dihydroxyethyl]phenyl]-2-oxopropyl]benzaldehyde.
| Compound Name | 4-[1-[4-[(1R)-1,2-dihydroxyethyl]phenyl]-2-oxopropyl]benzaldehyde |
|---|---|
| PubChem CID | 174850169 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-[1-[4-[(1R)-1,2-dihydroxyethyl]phenyl]-2-oxopropyl]benzaldehyde |
| SMILES | CC(=O)C(c1ccc(C=O)cc1)c1ccc([C@@H](O)CO)cc1 |
| InChI | InChI=1S/C18H18O4/c1-12(21)18(15-4-2-13(10-19)3-5-15)16-8-6-14(7-9-16)17(22)11-20/h2-10,17-18,20,22H,11H2,1H3/t17-,18?/m0/s1 |
| InChIKey | RKBVDEIBHSPVSZ-ZENAZSQFSA-N |
| XLogP | 2.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|