C11H15NO3 — CID 117298432
1-[4-(1,2-dihydroxyethyl)phenyl]-2-(methylamino)ethanone (PubChem CID 117298432) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-[4-(1,2-dihydroxyethyl)phenyl]-2-(methylamino)ethanone.
| Compound Name | 1-[4-(1,2-dihydroxyethyl)phenyl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 117298432 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-[4-(1,2-dihydroxyethyl)phenyl]-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1ccc(C(O)CO)cc1 |
| InChI | InChI=1S/C11H15NO3/c1-12-6-10(14)8-2-4-9(5-3-8)11(15)7-13/h2-5,11-13,15H,6-7H2,1H3 |
| InChIKey | DEIVLJRMDYWUFC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |