C12H11Cl3O2 — CID 11808513
[(E,2S)-1,1,1-trichloro-4-phenylbut-3-en-2-yl] acetate (PubChem CID 11808513) has the molecular formula C12H11Cl3O2 and a molecular weight of 293.58 g/mol. Its IUPAC name is [(E,2S)-1,1,1-trichloro-4-phenylbut-3-en-2-yl] acetate.
| Compound Name | [(E,2S)-1,1,1-trichloro-4-phenylbut-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 11808513 |
| Molecular Formula | C12H11Cl3O2 |
| Molecular Weight | 293.58 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | [(E,2S)-1,1,1-trichloro-4-phenylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](/C=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H11Cl3O2/c1-9(16)17-11(12(13,14)15)8-7-10-5-3-2-4-6-10/h2-8,11H,1H3/b8-7+/t11-/m0/s1 |
| InChIKey | RWNGQZVBHVTLCT-AEZGRPFRSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|