C13H14O3 — CID 54768294
[(E,3R)-5-oxo-1-phenylpent-1-en-3-yl] acetate (PubChem CID 54768294) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is [(E,3R)-5-oxo-1-phenylpent-1-en-3-yl] acetate.
| Compound Name | [(E,3R)-5-oxo-1-phenylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 54768294 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | [(E,3R)-5-oxo-1-phenylpent-1-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](/C=C/c1ccccc1)CC=O |
| InChI | InChI=1S/C13H14O3/c1-11(15)16-13(9-10-14)8-7-12-5-3-2-4-6-12/h2-8,10,13H,9H2,1H3/b8-7+/t13-/m0/s1 |
| InChIKey | AWBHMEOKZNFVLE-GWJCSSMESA-N |
| XLogP | 2.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|