C20H22O2S — CID 11045639
(E,3S,5S)-5-methoxy-7-phenyl-3-phenylsulfanylhept-6-enal (PubChem CID 11045639) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is (E,3S,5S)-5-methoxy-7-phenyl-3-phenylsulfanylhept-6-enal.
| Compound Name | (E,3S,5S)-5-methoxy-7-phenyl-3-phenylsulfanylhept-6-enal |
|---|---|
| PubChem CID | 11045639 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (E,3S,5S)-5-methoxy-7-phenyl-3-phenylsulfanylhept-6-enal |
| SMILES | CO[C@H](/C=C/c1ccccc1)CC(CC=O)Sc1ccccc1 |
| InChI | InChI=1S/C20H22O2S/c1-22-18(13-12-17-8-4-2-5-9-17)16-20(14-15-21)23-19-10-6-3-7-11-19/h2-13,15,18,20H,14,16H2,1H3/b13-12+/t18-,20?/m1/s1 |
| InChIKey | MDBKWAXNRJQQNX-ZFMFNCFHSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|