C15H20O4 — CID 135058828
methyl (E,2S)-2-(2-methoxyethoxymethyl)-4-phenylbut-3-enoate (PubChem CID 135058828) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl (E,2S)-2-(2-methoxyethoxymethyl)-4-phenylbut-3-enoate.
| Compound Name | methyl (E,2S)-2-(2-methoxyethoxymethyl)-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 135058828 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl (E,2S)-2-(2-methoxyethoxymethyl)-4-phenylbut-3-enoate |
| SMILES | COCCOC[C@H](/C=C/c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H20O4/c1-17-10-11-19-12-14(15(16)18-2)9-8-13-6-4-3-5-7-13/h3-9,14H,10-12H2,1-2H3/b9-8+/t14-/m0/s1 |
| InChIKey | MRYQLYDTEFQRCN-VFNNOXKTSA-N |
| XLogP | 2.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|