C13H19NO7S — CID 14050282
1-(benzenesulfonyl)-N-(2-methoxyethyl)ethanamine;oxalic acid (PubChem CID 14050282) has the molecular formula C13H19NO7S and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(2-methoxyethyl)ethanamine;oxalic acid.
| Compound Name | 1-(benzenesulfonyl)-N-(2-methoxyethyl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 14050282 |
| Molecular Formula | C13H19NO7S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(2-methoxyethyl)ethanamine;oxalic acid |
| SMILES | COCCNC(C)S(=O)(=O)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H17NO3S.C2H2O4/c1-10(12-8-9-15-2)16(13,14)11-6-4-3-5-7-11;3-1(4)2(5)6/h3-7,10,12H,8-9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | BIMXAIFQBJXAAL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|