C16H14Cl2O2S — CID 134950152
1,4-dichloro-2-[(E,2R)-4-phenylbut-3-en-2-yl]sulfonylbenzene (PubChem CID 134950152) has the molecular formula C16H14Cl2O2S and a molecular weight of 341.26 g/mol. Its IUPAC name is 1,4-dichloro-2-[(E,2R)-4-phenylbut-3-en-2-yl]sulfonylbenzene.
| Compound Name | 1,4-dichloro-2-[(E,2R)-4-phenylbut-3-en-2-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 134950152 |
| Molecular Formula | C16H14Cl2O2S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1,4-dichloro-2-[(E,2R)-4-phenylbut-3-en-2-yl]sulfonylbenzene |
| SMILES | C[C@H](/C=C/c1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2O2S/c1-12(7-8-13-5-3-2-4-6-13)21(19,20)16-11-14(17)9-10-15(16)18/h2-12H,1H3/b8-7+/t12-/m1/s1 |
| InChIKey | PFECPKRDEDPZHI-ABZNLYFFSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |