C15H12Cl2O3S — CID 64644275
2-(2,5-dichlorophenyl)sulfonyl-1-phenylpropan-1-one (PubChem CID 64644275) has the molecular formula C15H12Cl2O3S and a molecular weight of 343.23 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonyl-1-phenylpropan-1-one.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 64644275 |
| Molecular Formula | C15H12Cl2O3S |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonyl-1-phenylpropan-1-one |
| SMILES | CC(C(=O)c1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2O3S/c1-10(15(18)11-5-3-2-4-6-11)21(19,20)14-9-12(16)7-8-13(14)17/h2-10H,1H3 |
| InChIKey | IPOKLXQDTXSSIO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |