C14H10Cl2NO3S- — CID 4745426
(3-acetylphenyl)-(2,5-dichlorophenyl)sulfonylazanide (PubChem CID 4745426) has the molecular formula C14H10Cl2NO3S- and a molecular weight of 343.21 g/mol. Its IUPAC name is (3-acetylphenyl)-(2,5-dichlorophenyl)sulfonylazanide.
| Compound Name | (3-acetylphenyl)-(2,5-dichlorophenyl)sulfonylazanide |
|---|---|
| PubChem CID | 4745426 |
| Molecular Formula | C14H10Cl2NO3S- |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | (3-acetylphenyl)-(2,5-dichlorophenyl)sulfonylazanide |
| SMILES | CC(=O)c1cccc([N-]S(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2NO3S/c1-9(18)10-3-2-4-12(7-10)17-21(19,20)14-8-11(15)5-6-13(14)16/h2-8H,1H3/q-1 |
| InChIKey | CBMWTWIMCYEMJU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |