C14H10Cl2O — CID 39232724
1-[3-(2,5-dichlorophenyl)phenyl]ethanone (PubChem CID 39232724) has the molecular formula C14H10Cl2O and a molecular weight of 265.14 g/mol. Its IUPAC name is 1-[3-(2,5-dichlorophenyl)phenyl]ethanone.
| Compound Name | 1-[3-(2,5-dichlorophenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 39232724 |
| Molecular Formula | C14H10Cl2O |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-[3-(2,5-dichlorophenyl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O/c1-9(17)10-3-2-4-11(7-10)13-8-12(15)5-6-14(13)16/h2-8H,1H3 |
| InChIKey | ILZQXLAVVNVJEB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |