C18H12Cl2 — CID 86205673
1,4-dichloro-2-(3-phenylphenyl)benzene (PubChem CID 86205673) has the molecular formula C18H12Cl2 and a molecular weight of 299.20 g/mol. Its IUPAC name is 1,4-dichloro-2-(3-phenylphenyl)benzene.
| Compound Name | 1,4-dichloro-2-(3-phenylphenyl)benzene |
|---|---|
| PubChem CID | 86205673 |
| Molecular Formula | C18H12Cl2 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1,4-dichloro-2-(3-phenylphenyl)benzene |
| SMILES | Clc1ccc(Cl)c(-c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C18H12Cl2/c19-16-9-10-18(20)17(12-16)15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-12H |
| InChIKey | OKCBUQXNXGBLGR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |