C18H17Cl2N3O5S — CID 25336969
1-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]ethanone (PubChem CID 25336969) has the molecular formula C18H17Cl2N3O5S and a molecular weight of 458.32 g/mol. Its IUPAC name is 1-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 25336969 |
| Molecular Formula | C18H17Cl2N3O5S |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 1-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(S(=O)(=O)c3cc(Cl)ccc3Cl)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17Cl2N3O5S/c1-12(24)13-2-5-16(17(10-13)23(25)26)21-6-8-22(9-7-21)29(27,28)18-11-14(19)3-4-15(18)20/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | FWZJNNOBLDLEED-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|