C9H10Cl2O3S — CID 87077321
propan-2-yl 2,5-dichlorobenzenesulfonate (PubChem CID 87077321) has the molecular formula C9H10Cl2O3S and a molecular weight of 269.15 g/mol. Its IUPAC name is propan-2-yl 2,5-dichlorobenzenesulfonate.
| Compound Name | propan-2-yl 2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87077321 |
| Molecular Formula | C9H10Cl2O3S |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | propan-2-yl 2,5-dichlorobenzenesulfonate |
| SMILES | CC(C)OS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H10Cl2O3S/c1-6(2)14-15(12,13)9-5-7(10)3-4-8(9)11/h3-6H,1-2H3 |
| InChIKey | XVGARJFXKBDLSU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|