C15H11Cl3O5S — CID 87948366
methyl (2R)-2-(2-chlorophenyl)-2-(2,5-dichlorophenyl)sulfonyloxyacetate (PubChem CID 87948366) has the molecular formula C15H11Cl3O5S and a molecular weight of 409.67 g/mol. Its IUPAC name is methyl (2R)-2-(2-chlorophenyl)-2-(2,5-dichlorophenyl)sulfonyloxyacetate.
| Compound Name | methyl (2R)-2-(2-chlorophenyl)-2-(2,5-dichlorophenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 87948366 |
| Molecular Formula | C15H11Cl3O5S |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | methyl (2R)-2-(2-chlorophenyl)-2-(2,5-dichlorophenyl)sulfonyloxyacetate |
| SMILES | COC(=O)[C@H](OS(=O)(=O)c1cc(Cl)ccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl3O5S/c1-22-15(19)14(10-4-2-3-5-11(10)17)23-24(20,21)13-8-9(16)6-7-12(13)18/h2-8,14H,1H3/t14-/m1/s1 |
| InChIKey | WRNCAJVYSZFDPH-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|