C19H21Cl2N2O2S+ — CID 6200212
1-(2,5-dichlorophenyl)sulfonyl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium (PubChem CID 6200212) has the molecular formula C19H21Cl2N2O2S+ and a molecular weight of 412.36 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6200212 |
| Molecular Formula | C19H21Cl2N2O2S+ |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CC[NH+](C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O2S/c20-17-8-9-18(21)19(15-17)26(24,25)23-13-11-22(12-14-23)10-4-7-16-5-2-1-3-6-16/h1-9,15H,10-14H2/p+1/b7-4+ |
| InChIKey | VYBPXKMCRHJFNB-QPJJXVBHSA-O |
| XLogP | 2.60 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |