C21H24N2O5S — CID 8831411
4-methoxy-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]sulfonylbenzoate (PubChem CID 8831411) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-methoxy-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]sulfonylbenzoate.
| Compound Name | 4-methoxy-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 8831411 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-methoxy-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]sulfonylbenzoate |
| SMILES | COc1ccc(C(=O)[O-])cc1S(=O)(=O)N1CC[NH+](C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O5S/c1-28-19-10-9-18(21(24)25)16-20(19)29(26,27)23-14-12-22(13-15-23)11-5-8-17-6-3-2-4-7-17/h2-10,16H,11-15H2,1H3,(H,24,25)/b8-5+ |
| InChIKey | PPHRNTOXPKGGQJ-VMPITWQZSA-N |
| XLogP | -0.34 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |