C21H25ClN2O — CID 18531800
(4-methylphenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone chloride (PubChem CID 18531800) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is (4-methylphenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone chloride.
| Compound Name | (4-methylphenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone chloride |
|---|---|
| PubChem CID | 18531800 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (4-methylphenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone chloride |
| SMILES | Cc1ccc(C(=O)N2CC[NH+](C/C=C/c3ccccc3)CC2)cc1.[Cl-] |
| InChI | InChI=1S/C21H24N2O.ClH/c1-18-9-11-20(12-10-18)21(24)23-16-14-22(15-17-23)13-5-8-19-6-3-2-4-7-19;/h2-12H,13-17H2,1H3;1H/b8-5+; |
| InChIKey | LGMKYSLQKDAAOF-HAAWTFQLSA-N |
| XLogP | -0.95 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |