C20H30N3O+ — CID 3564830
N-cyclohexyl-4-(3-phenylprop-2-enyl)piperazin-4-ium-1-carboxamide (PubChem CID 3564830) has the molecular formula C20H30N3O+ and a molecular weight of 328.48 g/mol. Its IUPAC name is N-cyclohexyl-4-(3-phenylprop-2-enyl)piperazin-4-ium-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(3-phenylprop-2-enyl)piperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 3564830 |
| Molecular Formula | C20H30N3O+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | N-cyclohexyl-4-(3-phenylprop-2-enyl)piperazin-4-ium-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CC[NH+](CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H29N3O/c24-20(21-19-11-5-2-6-12-19)23-16-14-22(15-17-23)13-7-10-18-8-3-1-4-9-18/h1,3-4,7-10,19H,2,5-6,11-17H2,(H,21,24)/p+1 |
| InChIKey | CZTOPYHXTHGKAA-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |