C13H25N4O2+ — CID 2056603
4-(2-amino-2-oxoethyl)-N-cyclohexylpiperazin-4-ium-1-carboxamide (PubChem CID 2056603) has the molecular formula C13H25N4O2+ and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethyl)-N-cyclohexylpiperazin-4-ium-1-carboxamide.
| Compound Name | 4-(2-amino-2-oxoethyl)-N-cyclohexylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 2056603 |
| Molecular Formula | C13H25N4O2+ |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 4-(2-amino-2-oxoethyl)-N-cyclohexylpiperazin-4-ium-1-carboxamide |
| SMILES | NC(=O)C[NH+]1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C13H24N4O2/c14-12(18)10-16-6-8-17(9-7-16)13(19)15-11-4-2-1-3-5-11/h11H,1-10H2,(H2,14,18)(H,15,19)/p+1 |
| InChIKey | UNZBIXIRXYCTSE-UHFFFAOYSA-O |
| XLogP | -1.29 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |