C18H33N4O2+ — CID 7092122
1-N-cyclohexyl-4-piperidin-1-ium-1-ylpiperidine-1,4-dicarboxamide (PubChem CID 7092122) has the molecular formula C18H33N4O2+ and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-piperidin-1-ium-1-ylpiperidine-1,4-dicarboxamide.
| Compound Name | 1-N-cyclohexyl-4-piperidin-1-ium-1-ylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 7092122 |
| Molecular Formula | C18H33N4O2+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 1-N-cyclohexyl-4-piperidin-1-ium-1-ylpiperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1([NH+]2CCCCC2)CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H32N4O2/c19-16(23)18(22-11-5-2-6-12-22)9-13-21(14-10-18)17(24)20-15-7-3-1-4-8-15/h15H,1-14H2,(H2,19,23)(H,20,24)/p+1 |
| InChIKey | LNEFWEVPXMONGI-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |