C24H31N2O2+ — CID 9181538
(2S)-2-(4-methylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]butan-1-one (PubChem CID 9181538) has the molecular formula C24H31N2O2+ and a molecular weight of 379.52 g/mol. Its IUPAC name is (2S)-2-(4-methylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]butan-1-one.
| Compound Name | (2S)-2-(4-methylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]butan-1-one |
|---|---|
| PubChem CID | 9181538 |
| Molecular Formula | C24H31N2O2+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (2S)-2-(4-methylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]butan-1-one |
| SMILES | CC[C@H](Oc1ccc(C)cc1)C(=O)N1CC[NH+](C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-3-23(28-22-13-11-20(2)12-14-22)24(27)26-18-16-25(17-19-26)15-7-10-21-8-5-4-6-9-21/h4-14,23H,3,15-19H2,1-2H3/p+1/b10-7+/t23-/m0/s1 |
| InChIKey | HILNTLMMVZYSCN-KXOMFBTKSA-O |
| XLogP | 2.59 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |