C15H22ClN2O2+ — CID 9172627
(2S)-2-(4-chlorophenoxy)-1-(4-methylpiperazin-4-ium-1-yl)butan-1-one (PubChem CID 9172627) has the molecular formula C15H22ClN2O2+ and a molecular weight of 297.81 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-1-(4-methylpiperazin-4-ium-1-yl)butan-1-one.
| Compound Name | (2S)-2-(4-chlorophenoxy)-1-(4-methylpiperazin-4-ium-1-yl)butan-1-one |
|---|---|
| PubChem CID | 9172627 |
| Molecular Formula | C15H22ClN2O2+ |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-1-(4-methylpiperazin-4-ium-1-yl)butan-1-one |
| SMILES | CC[C@H](Oc1ccc(Cl)cc1)C(=O)N1CC[NH+](C)CC1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-3-14(20-13-6-4-12(16)5-7-13)15(19)18-10-8-17(2)9-11-18/h4-7,14H,3,8-11H2,1-2H3/p+1/t14-/m0/s1 |
| InChIKey | QTWMELOWEGPAMY-AWEZNQCLSA-O |
| XLogP | 0.85 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |