C24H28N3OS+ — CID 7350051
[6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone (PubChem CID 7350051) has the molecular formula C24H28N3OS+ and a molecular weight of 406.58 g/mol. Its IUPAC name is [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 7350051 |
| Molecular Formula | C24H28N3OS+ |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [6-[(Z)-but-2-enyl]thieno[2,3-b]pyrrol-5-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-yl]methanone |
| SMILES | C/C=C\Cn1c(C(=O)N2CC[NH+](C/C=C/c3ccccc3)CC2)cc2ccsc21 |
| InChI | InChI=1S/C24H27N3OS/c1-2-3-13-27-22(19-21-11-18-29-24(21)27)23(28)26-16-14-25(15-17-26)12-7-10-20-8-5-4-6-9-20/h2-11,18-19H,12-17H2,1H3/p+1/b3-2-,10-7+ |
| InChIKey | SXSZFXDHSXLDPO-FIGGESLUSA-O |
| XLogP | 3.33 |
| TPSA | 29.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|